C18H33IN6O — CID 111020934
2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111020934) has the molecular formula C18H33IN6O and a molecular weight of 476.41 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111020934 |
| Molecular Formula | C18H33IN6O |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[[2-(dimethylamino)-4-pyridinyl]methyl]-1-ethyl-3-(2-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(N(C)C)c1)NCC(C)N1CCOCC1.I |
| InChI | InChI=1S/C18H32N6O.HI/c1-5-19-18(21-13-15(2)24-8-10-25-11-9-24)22-14-16-6-7-20-17(12-16)23(3)4;/h6-7,12,15H,5,8-11,13-14H2,1-4H3,(H2,19,21,22);1H |
| InChIKey | XTCUPPUNEFMHHQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|