C19H29N7O — CID 111020713
1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111020713) has the molecular formula C19H29N7O and a molecular weight of 371.49 g/mol. Its IUPAC name is 1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111020713 |
| Molecular Formula | C19H29N7O |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 1-ethyl-3-(2-morpholin-4-ylpropyl)-2-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(-n2cccn2)c1)NCC(C)N1CCOCC1 |
| InChI | InChI=1S/C19H29N7O/c1-3-20-19(22-14-16(2)25-9-11-27-12-10-25)23-15-17-5-7-21-18(13-17)26-8-4-6-24-26/h4-8,13,16H,3,9-12,14-15H2,1-2H3,(H2,20,22,23) |
| InChIKey | GMOHKPVORUGYRD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|