C12H22IN5O — CID 120913497
2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 120913497) has the molecular formula C12H22IN5O and a molecular weight of 379.25 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120913497 |
| Molecular Formula | C12H22IN5O |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-[(2,5-dimethylpyrazol-3-yl)methyl]-1-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | Cc1cc(C/N=C(\N)NCC2CCCO2)n(C)n1.I |
| InChI | InChI=1S/C12H21N5O.HI/c1-9-6-10(17(2)16-9)7-14-12(13)15-8-11-4-3-5-18-11;/h6,11H,3-5,7-8H2,1-2H3,(H3,13,14,15);1H |
| InChIKey | PKFJHIUGVVJUJL-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|