C14H22BrN3O4 — CID 51127634
methyl 5-[[[amino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydrobromide (PubChem CID 51127634) has the molecular formula C14H22BrN3O4 and a molecular weight of 376.25 g/mol. Its IUPAC name is methyl 5-[[[amino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydrobromide.
| Compound Name | methyl 5-[[[amino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydrobromide |
|---|---|
| PubChem CID | 51127634 |
| Molecular Formula | C14H22BrN3O4 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | methyl 5-[[[amino-(oxolan-2-ylmethylamino)methylidene]amino]methyl]-2-methylfuran-3-carboxylate;hydrobromide |
| SMILES | Br.COC(=O)c1cc(C/N=C(\N)NCC2CCCO2)oc1C |
| InChI | InChI=1S/C14H21N3O4.BrH/c1-9-12(13(18)19-2)6-11(21-9)8-17-14(15)16-7-10-4-3-5-20-10;/h6,10H,3-5,7-8H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | FKCPLPMSJLYZBR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|