C16H18F2N4O3S — CID 38343741
4-(cyclopropylsulfamoyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylbenzamide (PubChem CID 38343741) has the molecular formula C16H18F2N4O3S and a molecular weight of 384.41 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylbenzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 38343741 |
| Molecular Formula | C16H18F2N4O3S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylbenzamide |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C16H18F2N4O3S/c1-21(10-14-19-8-9-22(14)16(17)18)15(23)11-2-6-13(7-3-11)26(24,25)20-12-4-5-12/h2-3,6-9,12,16,20H,4-5,10H2,1H3 |
| InChIKey | TZYQFEUWOXKELA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |