C11H12F2N6O — CID 38343857
3-amino-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpyrazine-2-carboxamide (PubChem CID 38343857) has the molecular formula C11H12F2N6O and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-amino-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 38343857 |
| Molecular Formula | C11H12F2N6O |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-amino-N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methylpyrazine-2-carboxamide |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)c1nccnc1N |
| InChI | InChI=1S/C11H12F2N6O/c1-18(6-7-15-4-5-19(7)11(12)13)10(20)8-9(14)17-3-2-16-8/h2-5,11H,6H2,1H3,(H2,14,17) |
| InChIKey | AUPKKQSDPMOTNR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |