C10H15F2N3O2 — CID 55024545
ethyl 2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]acetate (PubChem CID 55024545) has the molecular formula C10H15F2N3O2 and a molecular weight of 247.25 g/mol. Its IUPAC name is ethyl 2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]acetate.
| Compound Name | ethyl 2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]acetate |
|---|---|
| PubChem CID | 55024545 |
| Molecular Formula | C10H15F2N3O2 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | ethyl 2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)Cc1nccn1C(F)F |
| InChI | InChI=1S/C10H15F2N3O2/c1-3-17-9(16)7-14(2)6-8-13-4-5-15(8)10(11)12/h4-5,10H,3,6-7H2,1-2H3 |
| InChIKey | DSRHECGDGAACFJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |