C11H13F2N5O2 — CID 103104810
ethyl 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-5-methyltriazole-4-carboxylate (PubChem CID 103104810) has the molecular formula C11H13F2N5O2 and a molecular weight of 285.25 g/mol. Its IUPAC name is ethyl 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | ethyl 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103104810 |
| Molecular Formula | C11H13F2N5O2 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-5-methyltriazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2nccn2C(F)F)c1C |
| InChI | InChI=1S/C11H13F2N5O2/c1-3-20-10(19)9-7(2)18(16-15-9)6-8-14-4-5-17(8)11(12)13/h4-5,11H,3,6H2,1-2H3 |
| InChIKey | ZYOOZQNQMZKPHZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |