C17H26F2N4O — CID 60500161
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]ethanone (PubChem CID 60500161) has the molecular formula C17H26F2N4O and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]ethanone |
|---|---|
| PubChem CID | 60500161 |
| Molecular Formula | C17H26F2N4O |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]ethanone |
| SMILES | CN(CC(=O)N1CCCC2CCCCC21)Cc1nccn1C(F)F |
| InChI | InChI=1S/C17H26F2N4O/c1-21(11-15-20-8-10-23(15)17(18)19)12-16(24)22-9-4-6-13-5-2-3-7-14(13)22/h8,10,13-14,17H,2-7,9,11-12H2,1H3 |
| InChIKey | DHZOTMDPMRBCKK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |