C15H22F2N4O — CID 119853701
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 119853701) has the molecular formula C15H22F2N4O and a molecular weight of 312.36 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 119853701 |
| Molecular Formula | C15H22F2N4O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CN(Cc1nccn1C(F)F)C(=O)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C15H22F2N4O/c1-20(9-13-18-6-7-21(13)15(16)17)14(22)12-8-10-4-2-3-5-11(10)19-12/h6-7,10-12,15,19H,2-5,8-9H2,1H3 |
| InChIKey | WMYKKBYPAGTSDU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |