C16H27Cl2N3OS — CID 91659787
N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 91659787) has the molecular formula C16H27Cl2N3OS and a molecular weight of 380.39 g/mol. Its IUPAC name is N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 91659787 |
| Molecular Formula | C16H27Cl2N3OS |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-[(2-ethyl-1,3-thiazol-5-yl)methyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | CCc1ncc(CN(C)C(=O)C2CC3CCCCC3N2)s1.Cl.Cl |
| InChI | InChI=1S/C16H25N3OS.2ClH/c1-3-15-17-9-12(21-15)10-19(2)16(20)14-8-11-6-4-5-7-13(11)18-14;;/h9,11,13-14,18H,3-8,10H2,1-2H3;2*1H |
| InChIKey | ABAVFCDVOGDRQV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |