C13H25ClN2O2 — CID 119280509
N-(2-methoxyethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119280509) has the molecular formula C13H25ClN2O2 and a molecular weight of 276.81 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-(2-methoxyethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119280509 |
| Molecular Formula | C13H25ClN2O2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-(2-methoxyethyl)-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COCCN(C)C(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C13H24N2O2.ClH/c1-15(7-8-17-2)13(16)12-9-10-5-3-4-6-11(10)14-12;/h10-12,14H,3-9H2,1-2H3;1H |
| InChIKey | VOAISZOMYCHHDH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |