C17H31ClN2O — CID 119328117
N-hept-6-enyl-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119328117) has the molecular formula C17H31ClN2O and a molecular weight of 314.90 g/mol. Its IUPAC name is N-hept-6-enyl-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-hept-6-enyl-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119328117 |
| Molecular Formula | C17H31ClN2O |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | N-hept-6-enyl-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | C=CCCCCCN(C)C(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C17H30N2O.ClH/c1-3-4-5-6-9-12-19(2)17(20)16-13-14-10-7-8-11-15(14)18-16;/h3,14-16,18H,1,4-13H2,2H3;1H |
| InChIKey | CFRURLOBHIZKDX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|