C14H27ClN2O — CID 119280649
N-ethyl-N-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119280649) has the molecular formula C14H27ClN2O and a molecular weight of 274.84 g/mol. Its IUPAC name is N-ethyl-N-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-ethyl-N-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119280649 |
| Molecular Formula | C14H27ClN2O |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-ethyl-N-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CCCN(CC)C(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C14H26N2O.ClH/c1-3-9-16(4-2)14(17)13-10-11-7-5-6-8-12(11)15-13;/h11-13,15H,3-10H2,1-2H3;1H |
| InChIKey | QPHDIDDUEBESSN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |