C16H30ClN3O3 — CID 119274183
N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride (PubChem CID 119274183) has the molecular formula C16H30ClN3O3 and a molecular weight of 347.89 g/mol. Its IUPAC name is N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119274183 |
| Molecular Formula | C16H30ClN3O3 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;hydrochloride |
| SMILES | COCCCNC(=O)CN(C)C(=O)C1CC2CCCCC2N1.Cl |
| InChI | InChI=1S/C16H29N3O3.ClH/c1-19(11-15(20)17-8-5-9-22-2)16(21)14-10-12-6-3-4-7-13(12)18-14;/h12-14,18H,3-11H2,1-2H3,(H,17,20);1H |
| InChIKey | JKTBYBBLJOVOGQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|