C11H22ClN3O3S — CID 119274181
N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119274181) has the molecular formula C11H22ClN3O3S and a molecular weight of 311.84 g/mol. Its IUPAC name is N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119274181 |
| Molecular Formula | C11H22ClN3O3S |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | COCCCNC(=O)CN(C)C(=O)C1CSCN1.Cl |
| InChI | InChI=1S/C11H21N3O3S.ClH/c1-14(11(16)9-7-18-8-13-9)6-10(15)12-4-3-5-17-2;/h9,13H,3-8H2,1-2H3,(H,12,15);1H |
| InChIKey | UZDDXWIPPPQDGZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|