C6H12N2O2S — CID 22922472
N-methoxy-N-methyl-1,3-thiazolidine-4-carboxamide (PubChem CID 22922472) has the molecular formula C6H12N2O2S and a molecular weight of 176.24 g/mol. Its IUPAC name is N-methoxy-N-methyl-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-methoxy-N-methyl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 22922472 |
| Molecular Formula | C6H12N2O2S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | N-methoxy-N-methyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CON(C)C(=O)C1CSCN1 |
| InChI | InChI=1S/C6H12N2O2S/c1-8(10-2)6(9)5-3-11-4-7-5/h5,7H,3-4H2,1-2H3 |
| InChIKey | ORDVZRASWAKWNY-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|