C7H13FN2O2 — CID 130686259
(2S,4R)-4-fluoro-N-methoxy-N-methylpyrrolidine-2-carboxamide (PubChem CID 130686259) has the molecular formula C7H13FN2O2 and a molecular weight of 176.19 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-N-methoxy-N-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-fluoro-N-methoxy-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 130686259 |
| Molecular Formula | C7H13FN2O2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2S,4R)-4-fluoro-N-methoxy-N-methylpyrrolidine-2-carboxamide |
| SMILES | CON(C)C(=O)[C@@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C7H13FN2O2/c1-10(12-2)7(11)6-3-5(8)4-9-6/h5-6,9H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | AHRSAOUIVPWDAD-RITPCOANSA-N |
| XLogP | -0.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|