C9H13F2NO2 — CID 137407926
6,6-difluoro-N-methoxy-N-methylbicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 137407926) has the molecular formula C9H13F2NO2 and a molecular weight of 205.20 g/mol. Its IUPAC name is 6,6-difluoro-N-methoxy-N-methylbicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | 6,6-difluoro-N-methoxy-N-methylbicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 137407926 |
| Molecular Formula | C9H13F2NO2 |
| Molecular Weight | 205.20 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 6,6-difluoro-N-methoxy-N-methylbicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CON(C)C(=O)C1CC2C(C1)C2(F)F |
| InChI | InChI=1S/C9H13F2NO2/c1-12(14-2)8(13)5-3-6-7(4-5)9(6,10)11/h5-7H,3-4H2,1-2H3 |
| InChIKey | CDDFIXVQCICFML-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|