C8H15NO3 — CID 114826107
N-methoxy-N,5-dimethyloxolane-3-carboxamide (PubChem CID 114826107) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N-methoxy-N,5-dimethyloxolane-3-carboxamide.
| Compound Name | N-methoxy-N,5-dimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 114826107 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-methoxy-N,5-dimethyloxolane-3-carboxamide |
| SMILES | CON(C)C(=O)C1COC(C)C1 |
| InChI | InChI=1S/C8H15NO3/c1-6-4-7(5-12-6)8(10)9(2)11-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | ITPFCZLMPHHVBX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|