C10H18ClNO2 — CID 114823103
N-(2-chloropropyl)-N,5-dimethyloxolane-3-carboxamide (PubChem CID 114823103) has the molecular formula C10H18ClNO2 and a molecular weight of 219.71 g/mol. Its IUPAC name is N-(2-chloropropyl)-N,5-dimethyloxolane-3-carboxamide.
| Compound Name | N-(2-chloropropyl)-N,5-dimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 114823103 |
| Molecular Formula | C10H18ClNO2 |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | N-(2-chloropropyl)-N,5-dimethyloxolane-3-carboxamide |
| SMILES | CC(Cl)CN(C)C(=O)C1COC(C)C1 |
| InChI | InChI=1S/C10H18ClNO2/c1-7(11)5-12(3)10(13)9-4-8(2)14-6-9/h7-9H,4-6H2,1-3H3 |
| InChIKey | JHQSIVZAPJDTNV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|