C9H16FNO — CID 90709568
1-(4-fluoropyrrolidin-2-yl)-2-methylbutan-1-one (PubChem CID 90709568) has the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. Its IUPAC name is 1-(4-fluoropyrrolidin-2-yl)-2-methylbutan-1-one.
| Compound Name | 1-(4-fluoropyrrolidin-2-yl)-2-methylbutan-1-one |
|---|---|
| PubChem CID | 90709568 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-(4-fluoropyrrolidin-2-yl)-2-methylbutan-1-one |
| SMILES | CCC(C)C(=O)C1CC(F)CN1 |
| InChI | InChI=1S/C9H16FNO/c1-3-6(2)9(12)8-4-7(10)5-11-8/h6-8,11H,3-5H2,1-2H3 |
| InChIKey | BXGYVWCGTMYYHL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |