C10H15Cl2FN2O — CID 118218020
(2S,4R)-N-[(1R)-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 118218020) has the molecular formula C10H15Cl2FN2O and a molecular weight of 269.15 g/mol. Its IUPAC name is (2S,4R)-N-[(1R)-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1R)-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118218020 |
| Molecular Formula | C10H15Cl2FN2O |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | (2S,4R)-N-[(1R)-1-[(1R)-2,2-dichlorocyclopropyl]ethyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | C[C@@H](NC(=O)[C@@H]1C[C@@H](F)CN1)[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C10H15Cl2FN2O/c1-5(7-3-10(7,11)12)15-9(16)8-2-6(13)4-14-8/h5-8,14H,2-4H2,1H3,(H,15,16)/t5-,6-,7-,8+/m1/s1 |
| InChIKey | PNFFLHUMTFJXOR-XUTVFYLZSA-N |
| XLogP | 1.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|