About (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride
(2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride (PubChem CID 131160678) has the molecular formula C8H15ClFN3O2
and a molecular weight of 239.68 g/mol. Its IUPAC name is (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride |
| PubChem CID | 131160678 |
| Molecular Formula | C8H15ClFN3O2 |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CNC(=O)CNC(=O)[C@H]1C[C@H](F)CN1.Cl |
| InChI | InChI=1S/C8H14FN3O2.ClH/c1-10-7(13)4-12-8(14)6-2-5(9)3-11-6;/h5-6,11H,2-4H2,1H3,(H,10,13)(H,12,14);1H/t5-,6+;/m0./s1 |
| InChIKey | LPJKLKZFNFHNJU-RIHPBJNCSA-N |
| XLogP | -1.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride?
The IUPAC name of (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride (CID 131160678) is (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride.
What is the SMILES notation for (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride?
The canonical SMILES for (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride is CNC(=O)CNC(=O)[C@H]1C[C@H](F)CN1.Cl.
What is the InChIKey of (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride?
The InChIKey is LPJKLKZFNFHNJU-RIHPBJNCSA-N. The full InChI is InChI=1S/C8H14FN3O2.ClH/c1-10-7(13)4-12-8(14)6-2-5(9)3-11-6;/h5-6,11H,2-4H2,1H3,(H,10,13)(H,12,14);1H/t5-,6+;/m0./s1.
What are the key properties of (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride?
(2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride has a molecular weight of 239.68 g/mol, XLogP of -1.03, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-fluoro-N-[2-(methylamino)-2-oxoethyl]pyrrolidine-2-carboxamide;hydrochloride is sourced from PubChem (CID 131160678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).