C9H16ClFN2O — CID 130758011
(2S,4R)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride (PubChem CID 130758011) has the molecular formula C9H16ClFN2O and a molecular weight of 222.69 g/mol. Its IUPAC name is (2S,4R)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | (2S,4R)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130758011 |
| Molecular Formula | C9H16ClFN2O |
| Molecular Weight | 222.69 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2S,4R)-N-but-3-en-2-yl-4-fluoropyrrolidine-2-carboxamide;hydrochloride |
| SMILES | C=CC(C)NC(=O)[C@@H]1C[C@@H](F)CN1.Cl |
| InChI | InChI=1S/C9H15FN2O.ClH/c1-3-6(2)12-9(13)8-4-7(10)5-11-8;/h3,6-8,11H,1,4-5H2,2H3,(H,12,13);1H/t6?,7-,8+;/m1./s1 |
| InChIKey | ZCRPRRYTPJPTOH-JPPRQWMHSA-N |
| XLogP | 0.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.69 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|