C9H14N2O2 — CID 115692112
N-but-3-en-2-yl-5-oxopyrrolidine-3-carboxamide (PubChem CID 115692112) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is N-but-3-en-2-yl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-but-3-en-2-yl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 115692112 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N-but-3-en-2-yl-5-oxopyrrolidine-3-carboxamide |
| SMILES | C=CC(C)NC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C9H14N2O2/c1-3-6(2)11-9(13)7-4-8(12)10-5-7/h3,6-7H,1,4-5H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | GNXCTXHOAFVULG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|