C9H16N2O2 — CID 78981963
N-tert-butyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 78981963) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-tert-butyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-tert-butyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78981963 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-tert-butyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C9H16N2O2/c1-9(2,3)11-8(13)6-4-7(12)10-5-6/h6H,4-5H2,1-3H3,(H,10,12)(H,11,13) |
| InChIKey | QLPIGWOWPQEMBY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |