C13H22N2O2 — CID 78998864
N-(3,5-dimethylcyclohexyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 78998864) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-(3,5-dimethylcyclohexyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(3,5-dimethylcyclohexyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 78998864 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | N-(3,5-dimethylcyclohexyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC1CC(C)CC(NC(=O)C2CNC(=O)C2)C1 |
| InChI | InChI=1S/C13H22N2O2/c1-8-3-9(2)5-11(4-8)15-13(17)10-6-12(16)14-7-10/h8-11H,3-7H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | QTFRUDHXMJYBPH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |