C12H22N2O2 — CID 102610483
5-oxo-N-(2,2,3-trimethylbutyl)pyrrolidine-3-carboxamide (PubChem CID 102610483) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-oxo-N-(2,2,3-trimethylbutyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-(2,2,3-trimethylbutyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 102610483 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 5-oxo-N-(2,2,3-trimethylbutyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)C(C)(C)CNC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C12H22N2O2/c1-8(2)12(3,4)7-14-11(16)9-5-10(15)13-6-9/h8-9H,5-7H2,1-4H3,(H,13,15)(H,14,16) |
| InChIKey | BGNBWCBKXHFKSB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |