C11H18N2O4 — CID 83193053
5-[(5-oxopyrrolidine-3-carbonyl)amino]hexanoic acid (PubChem CID 83193053) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-[(5-oxopyrrolidine-3-carbonyl)amino]hexanoic acid.
| Compound Name | 5-[(5-oxopyrrolidine-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 83193053 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5-[(5-oxopyrrolidine-3-carbonyl)amino]hexanoic acid |
| SMILES | CC(CCCC(=O)O)NC(=O)C1CNC(=O)C1 |
| InChI | InChI=1S/C11H18N2O4/c1-7(3-2-4-10(15)16)13-11(17)8-5-9(14)12-6-8/h7-8H,2-6H2,1H3,(H,12,14)(H,13,17)(H,15,16) |
| InChIKey | IJTSXKPHPXKKAM-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |