C12H18N2O6 — CID 107831330
(2R)-2-[(6-oxopiperidine-3-carbonyl)amino]hexanedioic acid (PubChem CID 107831330) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is (2R)-2-[(6-oxopiperidine-3-carbonyl)amino]hexanedioic acid.
| Compound Name | (2R)-2-[(6-oxopiperidine-3-carbonyl)amino]hexanedioic acid |
|---|---|
| PubChem CID | 107831330 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2R)-2-[(6-oxopiperidine-3-carbonyl)amino]hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)C1CCC(=O)NC1)C(=O)O |
| InChI | InChI=1S/C12H18N2O6/c15-9-5-4-7(6-13-9)11(18)14-8(12(19)20)2-1-3-10(16)17/h7-8H,1-6H2,(H,13,15)(H,14,18)(H,16,17)(H,19,20)/t7?,8-/m1/s1 |
| InChIKey | PZPWKRRMPWTQIE-BRFYHDHCSA-N |
| XLogP | -0.66 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |