C10H14N2O6 — CID 70530537
(2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 70530537) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 70530537 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C10H14N2O6/c13-7-3-1-5(11-7)9(16)12-6(10(17)18)2-4-8(14)15/h5-6H,1-4H2,(H,11,13)(H,12,16)(H,14,15)(H,17,18)/t5-,6-/m0/s1 |
| InChIKey | YRUFRJRFQFBNQR-WDSKDSINSA-N |
| XLogP | -1.30 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |