C9H12N2O5 — CID 173316807
(3S)-4-oxo-3-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 173316807) has the molecular formula C9H12N2O5 and a molecular weight of 228.20 g/mol. Its IUPAC name is (3S)-4-oxo-3-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | (3S)-4-oxo-3-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 173316807 |
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (3S)-4-oxo-3-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C9H12N2O5/c12-4-5(3-8(14)15)10-9(16)6-1-2-7(13)11-6/h4-6H,1-3H2,(H,10,16)(H,11,13)(H,14,15)/t5-,6-/m0/s1 |
| InChIKey | YHPVWFLWTRARNU-WDSKDSINSA-N |
| XLogP | -1.58 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|