C14H16N2O5 — CID 80563771
(2S)-2-(2,3-dihydro-1H-indole-2-carbonylamino)pentanedioic acid (PubChem CID 80563771) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1H-indole-2-carbonylamino)pentanedioic acid.
| Compound Name | (2S)-2-(2,3-dihydro-1H-indole-2-carbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 80563771 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1H-indole-2-carbonylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)C1Cc2ccccc2N1)C(=O)O |
| InChI | InChI=1S/C14H16N2O5/c17-12(18)6-5-10(14(20)21)16-13(19)11-7-8-3-1-2-4-9(8)15-11/h1-4,10-11,15H,5-7H2,(H,16,19)(H,17,18)(H,20,21)/t10-,11?/m0/s1 |
| InChIKey | ZWNISGGXEXUHLP-VUWPPUDQSA-N |
| XLogP | 0.46 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |