C11H16N2O6 — CID 83193700
(2S)-2-[(6-oxopiperidine-3-carbonyl)amino]pentanedioic acid (PubChem CID 83193700) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is (2S)-2-[(6-oxopiperidine-3-carbonyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(6-oxopiperidine-3-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 83193700 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (2S)-2-[(6-oxopiperidine-3-carbonyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)C1CCC(=O)NC1)C(=O)O |
| InChI | InChI=1S/C11H16N2O6/c14-8-3-1-6(5-12-8)10(17)13-7(11(18)19)2-4-9(15)16/h6-7H,1-5H2,(H,12,14)(H,13,17)(H,15,16)(H,18,19)/t6?,7-/m0/s1 |
| InChIKey | PWQDRDVCMXMTPM-MLWJPKLSSA-N |
| XLogP | -1.05 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |