C10H16N2O5 — CID 107822931
(2R)-4-hydroxy-2-[(6-oxopiperidine-3-carbonyl)amino]butanoic acid (PubChem CID 107822931) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(6-oxopiperidine-3-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[(6-oxopiperidine-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107822931 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2R)-4-hydroxy-2-[(6-oxopiperidine-3-carbonyl)amino]butanoic acid |
| SMILES | O=C1CCC(C(=O)N[C@H](CCO)C(=O)O)CN1 |
| InChI | InChI=1S/C10H16N2O5/c13-4-3-7(10(16)17)12-9(15)6-1-2-8(14)11-5-6/h6-7,13H,1-5H2,(H,11,14)(H,12,15)(H,16,17)/t6?,7-/m1/s1 |
| InChIKey | LOJFFDONMUWBNL-COBSHVIPSA-N |
| XLogP | -1.54 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |