C10H15NO5 — CID 60657073
2-(cyclobutanecarbonylamino)pentanedioic acid (PubChem CID 60657073) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-(cyclobutanecarbonylamino)pentanedioic acid.
| Compound Name | 2-(cyclobutanecarbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 60657073 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-(cyclobutanecarbonylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)C1CCC1)C(=O)O |
| InChI | InChI=1S/C10H15NO5/c12-8(13)5-4-7(10(15)16)11-9(14)6-2-1-3-6/h6-7H,1-5H2,(H,11,14)(H,12,13)(H,15,16) |
| InChIKey | KCEXODRBKJYLIP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |