C10H15NO6 — CID 104855552
2-[[(2S)-oxolane-2-carbonyl]amino]pentanedioic acid (PubChem CID 104855552) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is 2-[[(2S)-oxolane-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[(2S)-oxolane-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 104855552 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[[(2S)-oxolane-2-carbonyl]amino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)[C@@H]1CCCO1)C(=O)O |
| InChI | InChI=1S/C10H15NO6/c12-8(13)4-3-6(10(15)16)11-9(14)7-2-1-5-17-7/h6-7H,1-5H2,(H,11,14)(H,12,13)(H,15,16)/t6?,7-/m0/s1 |
| InChIKey | VMMHITWWEPPZIJ-MLWJPKLSSA-N |
| XLogP | -0.40 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |