C11H17NO7 — CID 107831481
(2R)-2-(1,4-dioxane-2-carbonylamino)hexanedioic acid (PubChem CID 107831481) has the molecular formula C11H17NO7 and a molecular weight of 275.26 g/mol. Its IUPAC name is (2R)-2-(1,4-dioxane-2-carbonylamino)hexanedioic acid.
| Compound Name | (2R)-2-(1,4-dioxane-2-carbonylamino)hexanedioic acid |
|---|---|
| PubChem CID | 107831481 |
| Molecular Formula | C11H17NO7 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (2R)-2-(1,4-dioxane-2-carbonylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)C1COCCO1)C(=O)O |
| InChI | InChI=1S/C11H17NO7/c13-9(14)3-1-2-7(11(16)17)12-10(15)8-6-18-4-5-19-8/h7-8H,1-6H2,(H,12,15)(H,13,14)(H,16,17)/t7-,8?/m1/s1 |
| InChIKey | BUGDMACAIWOGKJ-GVHYBUMESA-N |
| XLogP | -0.77 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |