C10H15NO7 — CID 134130455
(2S)-2-(3-carboxypropanoylamino)hexanedioic acid (PubChem CID 134130455) has the molecular formula C10H15NO7 and a molecular weight of 261.23 g/mol. Its IUPAC name is (2S)-2-(3-carboxypropanoylamino)hexanedioic acid.
| Compound Name | (2S)-2-(3-carboxypropanoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 134130455 |
| Molecular Formula | C10H15NO7 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2S)-2-(3-carboxypropanoylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@H](NC(=O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H15NO7/c12-7(4-5-9(15)16)11-6(10(17)18)2-1-3-8(13)14/h6H,1-5H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t6-/m0/s1 |
| InChIKey | UVTJCHZIYQFHKA-LURJTMIESA-N |
| XLogP | -0.32 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |