C15H25NO5 — CID 107831353
(2R)-2-(3-cyclohexylpropanoylamino)hexanedioic acid (PubChem CID 107831353) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is (2R)-2-(3-cyclohexylpropanoylamino)hexanedioic acid.
| Compound Name | (2R)-2-(3-cyclohexylpropanoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 107831353 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (2R)-2-(3-cyclohexylpropanoylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)CCC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C15H25NO5/c17-13(10-9-11-5-2-1-3-6-11)16-12(15(20)21)7-4-8-14(18)19/h11-12H,1-10H2,(H,16,17)(H,18,19)(H,20,21)/t12-/m1/s1 |
| InChIKey | GMHMNQZPAMCOAP-GFCCVEGCSA-N |
| XLogP | 2.17 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |