C9H13NO7 — CID 87693716
(2S)-2-(4-carboxybutanoylamino)butanedioic acid (PubChem CID 87693716) has the molecular formula C9H13NO7 and a molecular weight of 247.20 g/mol. Its IUPAC name is (2S)-2-(4-carboxybutanoylamino)butanedioic acid.
| Compound Name | (2S)-2-(4-carboxybutanoylamino)butanedioic acid |
|---|---|
| PubChem CID | 87693716 |
| Molecular Formula | C9H13NO7 |
| Molecular Weight | 247.20 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (2S)-2-(4-carboxybutanoylamino)butanedioic acid |
| SMILES | O=C(O)CCCC(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H13NO7/c11-6(2-1-3-7(12)13)10-5(9(16)17)4-8(14)15/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t5-/m0/s1 |
| InChIKey | SLWTZAMGLJHWDB-YFKPBYRVSA-N |
| XLogP | -0.71 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |