C12H19N3O5 — CID 137427814
(Z)-2-(4-carboxybutanoylamino)-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid (PubChem CID 137427814) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is (Z)-2-(4-carboxybutanoylamino)-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid.
| Compound Name | (Z)-2-(4-carboxybutanoylamino)-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 137427814 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (Z)-2-(4-carboxybutanoylamino)-5-(methylamino)-4-(methylideneamino)pent-4-enoic acid |
| SMILES | C=N/C(=C\NC)CC(NC(=O)CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19N3O5/c1-13-7-8(14-2)6-9(12(19)20)15-10(16)4-3-5-11(17)18/h7,9,13H,2-6H2,1H3,(H,15,16)(H,17,18)(H,19,20)/b8-7- |
| InChIKey | VZTJVWHIBJHJLA-FPLPWBNLSA-N |
| XLogP | -0.04 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|