5-(1-carboxyethylamino)-5-oxopentanoic acid

C8H13NO5 — CID 20586207

IUPAC5-(1-carboxyethylamino)-5-oxopentanoic acid
SMILESCC(NC(=O)CCCC(=O)O)C(=O)O
InChIInChI=1S/C8H13NO5/c1-5(8(13)14)9-6(10)3-2-4-7(11)12/h5H,2-4H2,1H3,(H,9,10)(H,11,12)(H,13,14)
InChIKeyQAICKUPFZDJHPP-UHFFFAOYSA-N
MW203.19 g/mol
LogP-0.17
Rot. Bonds6

About 5-(1-carboxyethylamino)-5-oxopentanoic acid

5-(1-carboxyethylamino)-5-oxopentanoic acid (PubChem CID 20586207) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is 5-(1-carboxyethylamino)-5-oxopentanoic acid.

Molecular Properties

Compound Name5-(1-carboxyethylamino)-5-oxopentanoic acid
PubChem CID20586207
Molecular FormulaC8H13NO5
Molecular Weight203.19 g/mol
Exact Mass203.08
IUPAC Name5-(1-carboxyethylamino)-5-oxopentanoic acid
SMILESCC(NC(=O)CCCC(=O)O)C(=O)O
InChIInChI=1S/C8H13NO5/c1-5(8(13)14)9-6(10)3-2-4-7(11)12/h5H,2-4H2,1H3,(H,9,10)(H,11,12)(H,13,14)
InChIKeyQAICKUPFZDJHPP-UHFFFAOYSA-N
XLogP-0.17
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.19
LogP ≤ 5-0.17
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 5-(1-carboxyethylamino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-[[(1R)-1-carboxyethyl]amino]-5-oxopentanoic acid
CID 143725442
(2R)-2-[[22-[[(1R)-1-carboxyethyl]amino]-22-oxodocosanoyl]amino]propanoic acid
CID 100962390
(2R)-2-[[14-[[(1R)-1-carboxyethyl]amino]-14-oxotetradecanoyl]amino]propanoic acid
CID 100962387
5-oxo-5-[[(2S)-3-oxopentan-2-yl]amino]pentanoic acid
CID 89296216
2-(hexanoylamino)propanoic acid
CID 2828500
(2S)-2-(4-chlorobutanoylamino)propanoic acid
CID 18600219
(2S)-2-(3-hydroxypropanoylamino)propanoic acid
CID 126726083
(2S)-2-(heptanoylamino)propanoic acid
CID 59127847
[4-(1-carboxyethylamino)-4-oxobutyl]-trimethylazanium
CID 102170838
5-(3,3-dimethylbutan-2-ylamino)-5-oxopentanoic acid
CID 104827520
(2S)-2-(4-carboxybutanoylamino)butanedioic acid
CID 87693716
20-(1-hydroxyethylamino)-20-oxoicosanoic acid
CID 137417852

Frequently Asked Questions

What is the IUPAC name of 5-(1-carboxyethylamino)-5-oxopentanoic acid?
The IUPAC name of 5-(1-carboxyethylamino)-5-oxopentanoic acid (CID 20586207) is 5-(1-carboxyethylamino)-5-oxopentanoic acid.
What is the SMILES notation for 5-(1-carboxyethylamino)-5-oxopentanoic acid?
The canonical SMILES for 5-(1-carboxyethylamino)-5-oxopentanoic acid is CC(NC(=O)CCCC(=O)O)C(=O)O.
What is the InChIKey of 5-(1-carboxyethylamino)-5-oxopentanoic acid?
The InChIKey is QAICKUPFZDJHPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO5/c1-5(8(13)14)9-6(10)3-2-4-7(11)12/h5H,2-4H2,1H3,(H,9,10)(H,11,12)(H,13,14).
What are the key properties of 5-(1-carboxyethylamino)-5-oxopentanoic acid?
5-(1-carboxyethylamino)-5-oxopentanoic acid has a molecular weight of 203.19 g/mol, XLogP of -0.17, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-carboxyethylamino)-5-oxopentanoic acid is sourced from PubChem (CID 20586207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).