C12H19NO6 — CID 107831657
(2R)-2-[[2-(oxolan-2-yl)acetyl]amino]hexanedioic acid (PubChem CID 107831657) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is (2R)-2-[[2-(oxolan-2-yl)acetyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[2-(oxolan-2-yl)acetyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107831657 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2R)-2-[[2-(oxolan-2-yl)acetyl]amino]hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)CC1CCCO1)C(=O)O |
| InChI | InChI=1S/C12H19NO6/c14-10(7-8-3-2-6-19-8)13-9(12(17)18)4-1-5-11(15)16/h8-9H,1-7H2,(H,13,14)(H,15,16)(H,17,18)/t8?,9-/m1/s1 |
| InChIKey | BKXGNNDDQZUCID-YGPZHTELSA-N |
| XLogP | 0.38 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |