C12H21NO5 — CID 107821935
(2S)-4-hydroxy-2-[3-(oxan-2-yl)propanoylamino]butanoic acid (PubChem CID 107821935) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[3-(oxan-2-yl)propanoylamino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[3-(oxan-2-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 107821935 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2S)-4-hydroxy-2-[3-(oxan-2-yl)propanoylamino]butanoic acid |
| SMILES | O=C(CCC1CCCCO1)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C12H21NO5/c14-7-6-10(12(16)17)13-11(15)5-4-9-3-1-2-8-18-9/h9-10,14H,1-8H2,(H,13,15)(H,16,17)/t9?,10-/m0/s1 |
| InChIKey | VHNRRDIISCTSCD-AXDSSHIGSA-N |
| XLogP | 0.29 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |