C14H21N3O4 — CID 104894153
(2R)-3-(1H-imidazol-5-yl)-2-[3-(oxan-2-yl)propanoylamino]propanoic acid (PubChem CID 104894153) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2R)-3-(1H-imidazol-5-yl)-2-[3-(oxan-2-yl)propanoylamino]propanoic acid.
| Compound Name | (2R)-3-(1H-imidazol-5-yl)-2-[3-(oxan-2-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 104894153 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (2R)-3-(1H-imidazol-5-yl)-2-[3-(oxan-2-yl)propanoylamino]propanoic acid |
| SMILES | O=C(CCC1CCCCO1)N[C@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C14H21N3O4/c18-13(5-4-11-3-1-2-6-21-11)17-12(14(19)20)7-10-8-15-9-16-10/h8-9,11-12H,1-7H2,(H,15,16)(H,17,18)(H,19,20)/t11?,12-/m1/s1 |
| InChIKey | LHEMVFIJUFAWMH-PIJUOVFKSA-N |
| XLogP | 0.87 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |