C14H21N3O3S2 — CID 18396850
(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18396850) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18396850 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (2S)-2-[5-(dithiolan-3-yl)pentanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | O=C(CCCCC1CCSS1)N[C@@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C14H21N3O3S2/c18-13(4-2-1-3-11-5-6-21-22-11)17-12(14(19)20)7-10-8-15-9-16-10/h8-9,11-12H,1-7H2,(H,15,16)(H,17,18)(H,19,20)/t11?,12-/m0/s1 |
| InChIKey | YQEZPKFUEZIWIV-KIYNQFGBSA-N |
| XLogP | 2.24 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|