C14H21N3O3S2 — CID 174403595
2-amino-7-(dithiolan-3-yl)-2-(1H-imidazol-5-ylmethyl)-3-oxoheptanoic acid (PubChem CID 174403595) has the molecular formula C14H21N3O3S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-amino-7-(dithiolan-3-yl)-2-(1H-imidazol-5-ylmethyl)-3-oxoheptanoic acid.
| Compound Name | 2-amino-7-(dithiolan-3-yl)-2-(1H-imidazol-5-ylmethyl)-3-oxoheptanoic acid |
|---|---|
| PubChem CID | 174403595 |
| Molecular Formula | C14H21N3O3S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2-amino-7-(dithiolan-3-yl)-2-(1H-imidazol-5-ylmethyl)-3-oxoheptanoic acid |
| SMILES | NC(Cc1cnc[nH]1)(C(=O)O)C(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C14H21N3O3S2/c15-14(13(19)20,7-10-8-16-9-17-10)12(18)4-2-1-3-11-5-6-21-22-11/h8-9,11H,1-7,15H2,(H,16,17)(H,19,20) |
| InChIKey | XDXFUMMMLXZOHM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|