C10H19NO4 — CID 65312487
N-(1,3-dihydroxypropan-2-yl)-3-(oxolan-2-yl)propanamide (PubChem CID 65312487) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-(oxolan-2-yl)propanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-(oxolan-2-yl)propanamide |
|---|---|
| PubChem CID | 65312487 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-(oxolan-2-yl)propanamide |
| SMILES | O=C(CCC1CCCO1)NC(CO)CO |
| InChI | InChI=1S/C10H19NO4/c12-6-8(7-13)11-10(14)4-3-9-2-1-5-15-9/h8-9,12-13H,1-7H2,(H,11,14) |
| InChIKey | MBXQMOIWKKIFBN-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |